C21H30FN3O2 — CID 97227004
(3R,8aR)-N-(4-cyclopentyloxy-3-fluorophenyl)-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide (PubChem CID 97227004) has the molecular formula C21H30FN3O2 and a molecular weight of 375.49 g/mol. Its IUPAC name is (3R,8aR)-N-(4-cyclopentyloxy-3-fluorophenyl)-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide.
| Compound Name | (3R,8aR)-N-(4-cyclopentyloxy-3-fluorophenyl)-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 97227004 |
| Molecular Formula | C21H30FN3O2 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | (3R,8aR)-N-(4-cyclopentyloxy-3-fluorophenyl)-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide |
| SMILES | CC[C@@H]1CN2CCC[C@@H]2CN1C(=O)Nc1ccc(OC2CCCC2)c(F)c1 |
| InChI | InChI=1S/C21H30FN3O2/c1-2-16-13-24-11-5-6-17(24)14-25(16)21(26)23-15-9-10-20(19(22)12-15)27-18-7-3-4-8-18/h9-10,12,16-18H,2-8,11,13-14H2,1H3,(H,23,26)/t16-,17-/m1/s1 |
| InChIKey | WQYVKMTWYWANPX-IAGOWNOFSA-N |
| XLogP | 4.24 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |