C19H25N5O4 — CID 136515791
N-(2-benzamidoethyl)-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)piperidine-1-carboxamide (PubChem CID 136515791) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-(2-benzamidoethyl)-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)piperidine-1-carboxamide.
| Compound Name | N-(2-benzamidoethyl)-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 136515791 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-(2-benzamidoethyl)-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)piperidine-1-carboxamide |
| SMILES | CC1(C2CCCN(C(=O)NCCNC(=O)c3ccccc3)C2)NC(=O)NC1=O |
| InChI | InChI=1S/C19H25N5O4/c1-19(16(26)22-17(27)23-19)14-8-5-11-24(12-14)18(28)21-10-9-20-15(25)13-6-3-2-4-7-13/h2-4,6-7,14H,5,8-12H2,1H3,(H,20,25)(H,21,28)(H2,22,23,26,27) |
| InChIKey | NBNBBJMEOTUVFR-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|