C15H21N3O2S — CID 95780872
(5S)-5-methyl-5-[(3S)-1-(2-thiophen-2-ylethyl)piperidin-3-yl]imidazolidine-2,4-dione (PubChem CID 95780872) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is (5S)-5-methyl-5-[(3S)-1-(2-thiophen-2-ylethyl)piperidin-3-yl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-5-[(3S)-1-(2-thiophen-2-ylethyl)piperidin-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95780872 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | (5S)-5-methyl-5-[(3S)-1-(2-thiophen-2-ylethyl)piperidin-3-yl]imidazolidine-2,4-dione |
| SMILES | C[C@@]1([C@H]2CCCN(CCc3cccs3)C2)NC(=O)NC1=O |
| InChI | InChI=1S/C15H21N3O2S/c1-15(13(19)16-14(20)17-15)11-4-2-7-18(10-11)8-6-12-5-3-9-21-12/h3,5,9,11H,2,4,6-8,10H2,1H3,(H2,16,17,19,20)/t11-,15-/m0/s1 |
| InChIKey | IXWZTEUDGAZPDQ-NHYWBVRUSA-N |
| XLogP | 1.60 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|