C16H23N3O2S — CID 97090041
(5R)-3,5-dimethyl-5-[(3R)-1-(2-thiophen-2-ylethyl)piperidin-3-yl]imidazolidine-2,4-dione (PubChem CID 97090041) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is (5R)-3,5-dimethyl-5-[(3R)-1-(2-thiophen-2-ylethyl)piperidin-3-yl]imidazolidine-2,4-dione.
| Compound Name | (5R)-3,5-dimethyl-5-[(3R)-1-(2-thiophen-2-ylethyl)piperidin-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97090041 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | (5R)-3,5-dimethyl-5-[(3R)-1-(2-thiophen-2-ylethyl)piperidin-3-yl]imidazolidine-2,4-dione |
| SMILES | CN1C(=O)N[C@](C)([C@@H]2CCCN(CCc3cccs3)C2)C1=O |
| InChI | InChI=1S/C16H23N3O2S/c1-16(14(20)18(2)15(21)17-16)12-5-3-8-19(11-12)9-7-13-6-4-10-22-13/h4,6,10,12H,3,5,7-9,11H2,1-2H3,(H,17,21)/t12-,16-/m1/s1 |
| InChIKey | SFKQYWVWCCSJEV-MLGOLLRUSA-N |
| XLogP | 1.94 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|