C19H27N3O3 — CID 129462010
(5S)-5-[(3R)-1-[(2S)-2-hydroxy-2-(2-methylphenyl)ethyl]piperidin-3-yl]-3,5-dimethylimidazolidine-2,4-dione (PubChem CID 129462010) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is (5S)-5-[(3R)-1-[(2S)-2-hydroxy-2-(2-methylphenyl)ethyl]piperidin-3-yl]-3,5-dimethylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-[(3R)-1-[(2S)-2-hydroxy-2-(2-methylphenyl)ethyl]piperidin-3-yl]-3,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 129462010 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (5S)-5-[(3R)-1-[(2S)-2-hydroxy-2-(2-methylphenyl)ethyl]piperidin-3-yl]-3,5-dimethylimidazolidine-2,4-dione |
| SMILES | Cc1ccccc1[C@H](O)CN1CCC[C@@H]([C@]2(C)NC(=O)N(C)C2=O)C1 |
| InChI | InChI=1S/C19H27N3O3/c1-13-7-4-5-9-15(13)16(23)12-22-10-6-8-14(11-22)19(2)17(24)21(3)18(25)20-19/h4-5,7,9,14,16,23H,6,8,10-12H2,1-3H3,(H,20,25)/t14-,16-,19+/m1/s1 |
| InChIKey | UHVSKAXJCNJHQC-OGWOLHLISA-N |
| XLogP | 1.68 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|