C15H22N4O2S — CID 167903123
5-[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-3-yl]-5-methylimidazolidine-2,4-dione (PubChem CID 167903123) has the molecular formula C15H22N4O2S and a molecular weight of 322.43 g/mol. Its IUPAC name is 5-[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-3-yl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-3-yl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 167903123 |
| Molecular Formula | C15H22N4O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 5-[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-3-yl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCc1nc(CN2CCCC(C3(C)NC(=O)NC3=O)C2)cs1 |
| InChI | InChI=1S/C15H22N4O2S/c1-3-12-16-11(9-22-12)8-19-6-4-5-10(7-19)15(2)13(20)17-14(21)18-15/h9-10H,3-8H2,1-2H3,(H2,17,18,20,21) |
| InChIKey | JVPPKJNQUYICOF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|