C20H23FN2O4 — CID 136516484
N-[1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-1-(furan-3-carbonyl)piperidine-4-carboxamide (PubChem CID 136516484) has the molecular formula C20H23FN2O4 and a molecular weight of 374.41 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-1-(furan-3-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-1-(furan-3-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 136516484 |
| Molecular Formula | C20H23FN2O4 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | N-[1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-1-(furan-3-carbonyl)piperidine-4-carboxamide |
| SMILES | CC(NC(=O)C1CCN(C(=O)c2ccoc2)CC1)C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H23FN2O4/c1-13(18(24)14-2-4-17(21)5-3-14)22-19(25)15-6-9-23(10-7-15)20(26)16-8-11-27-12-16/h2-5,8,11-13,15,18,24H,6-7,9-10H2,1H3,(H,22,25) |
| InChIKey | WPIFVLBBWQVEPI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |