C14H20F3N3O — CID 136519197
3-[4-(2-methylpropoxy)piperidin-1-yl]-6-(trifluoromethyl)pyridazine (PubChem CID 136519197) has the molecular formula C14H20F3N3O and a molecular weight of 303.33 g/mol. Its IUPAC name is 3-[4-(2-methylpropoxy)piperidin-1-yl]-6-(trifluoromethyl)pyridazine.
| Compound Name | 3-[4-(2-methylpropoxy)piperidin-1-yl]-6-(trifluoromethyl)pyridazine |
|---|---|
| PubChem CID | 136519197 |
| Molecular Formula | C14H20F3N3O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 3-[4-(2-methylpropoxy)piperidin-1-yl]-6-(trifluoromethyl)pyridazine |
| SMILES | CC(C)COC1CCN(c2ccc(C(F)(F)F)nn2)CC1 |
| InChI | InChI=1S/C14H20F3N3O/c1-10(2)9-21-11-5-7-20(8-6-11)13-4-3-12(18-19-13)14(15,16)17/h3-4,10-11H,5-9H2,1-2H3 |
| InChIKey | LJQQBXFSOCXCQR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |