C16H26N4O2S — CID 136520505
N-(2-methylsulfonylcyclohexyl)-1-pyridazin-3-ylpiperidin-3-amine (PubChem CID 136520505) has the molecular formula C16H26N4O2S and a molecular weight of 338.48 g/mol. Its IUPAC name is N-(2-methylsulfonylcyclohexyl)-1-pyridazin-3-ylpiperidin-3-amine.
| Compound Name | N-(2-methylsulfonylcyclohexyl)-1-pyridazin-3-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 136520505 |
| Molecular Formula | C16H26N4O2S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | N-(2-methylsulfonylcyclohexyl)-1-pyridazin-3-ylpiperidin-3-amine |
| SMILES | CS(=O)(=O)C1CCCCC1NC1CCCN(c2cccnn2)C1 |
| InChI | InChI=1S/C16H26N4O2S/c1-23(21,22)15-8-3-2-7-14(15)18-13-6-5-11-20(12-13)16-9-4-10-17-19-16/h4,9-10,13-15,18H,2-3,5-8,11-12H2,1H3 |
| InChIKey | WFOGLIRONDLFPZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |