C19H23ClN4O2 — CID 136521083
N-[4-[(4-acetylpiperazin-1-yl)methyl]phenyl]-4-chloro-1-methylpyrrole-2-carboxamide (PubChem CID 136521083) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is N-[4-[(4-acetylpiperazin-1-yl)methyl]phenyl]-4-chloro-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[4-[(4-acetylpiperazin-1-yl)methyl]phenyl]-4-chloro-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 136521083 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N-[4-[(4-acetylpiperazin-1-yl)methyl]phenyl]-4-chloro-1-methylpyrrole-2-carboxamide |
| SMILES | CC(=O)N1CCN(Cc2ccc(NC(=O)c3cc(Cl)cn3C)cc2)CC1 |
| InChI | InChI=1S/C19H23ClN4O2/c1-14(25)24-9-7-23(8-10-24)12-15-3-5-17(6-4-15)21-19(26)18-11-16(20)13-22(18)2/h3-6,11,13H,7-10,12H2,1-2H3,(H,21,26) |
| InChIKey | YUERRGJHHIELFA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |