C15H20ClN3O2S — CID 136521741
2-chloro-4-cyano-N-[2-(3-methylpiperidin-1-yl)ethyl]benzenesulfonamide (PubChem CID 136521741) has the molecular formula C15H20ClN3O2S and a molecular weight of 341.86 g/mol. Its IUPAC name is 2-chloro-4-cyano-N-[2-(3-methylpiperidin-1-yl)ethyl]benzenesulfonamide.
| Compound Name | 2-chloro-4-cyano-N-[2-(3-methylpiperidin-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 136521741 |
| Molecular Formula | C15H20ClN3O2S |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-chloro-4-cyano-N-[2-(3-methylpiperidin-1-yl)ethyl]benzenesulfonamide |
| SMILES | CC1CCCN(CCNS(=O)(=O)c2ccc(C#N)cc2Cl)C1 |
| InChI | InChI=1S/C15H20ClN3O2S/c1-12-3-2-7-19(11-12)8-6-18-22(20,21)15-5-4-13(10-17)9-14(15)16/h4-5,9,12,18H,2-3,6-8,11H2,1H3 |
| InChIKey | XUUUDLJXQUEWGE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |