C20H22N4O4 — CID 136522609
1-cyclopentyl-N-cyclopropyl-N-(2,5-dioxopyrrolidin-3-yl)-2-oxo-3H-benzimidazole-5-carboxamide (PubChem CID 136522609) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 1-cyclopentyl-N-cyclopropyl-N-(2,5-dioxopyrrolidin-3-yl)-2-oxo-3H-benzimidazole-5-carboxamide.
| Compound Name | 1-cyclopentyl-N-cyclopropyl-N-(2,5-dioxopyrrolidin-3-yl)-2-oxo-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 136522609 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 1-cyclopentyl-N-cyclopropyl-N-(2,5-dioxopyrrolidin-3-yl)-2-oxo-3H-benzimidazole-5-carboxamide |
| SMILES | O=C1CC(N(C(=O)c2ccc3c(c2)[nH]c(=O)n3C2CCCC2)C2CC2)C(=O)N1 |
| InChI | InChI=1S/C20H22N4O4/c25-17-10-16(18(26)22-17)23(13-6-7-13)19(27)11-5-8-15-14(9-11)21-20(28)24(15)12-3-1-2-4-12/h5,8-9,12-13,16H,1-4,6-7,10H2,(H,21,28)(H,22,25,26) |
| InChIKey | GZPJCTXCFIHEBV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|