C20H27N3O2 — CID 3232123
N,1-dicyclohexyl-2-oxo-3H-benzimidazole-5-carboxamide (PubChem CID 3232123) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is N,1-dicyclohexyl-2-oxo-3H-benzimidazole-5-carboxamide.
| Compound Name | N,1-dicyclohexyl-2-oxo-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 3232123 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | N,1-dicyclohexyl-2-oxo-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1ccc2c(c1)[nH]c(=O)n2C1CCCCC1 |
| InChI | InChI=1S/C20H27N3O2/c24-19(21-15-7-3-1-4-8-15)14-11-12-18-17(13-14)22-20(25)23(18)16-9-5-2-6-10-16/h11-13,15-16H,1-10H2,(H,21,24)(H,22,25) |
| InChIKey | MSNSNXMDRKDWNQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |