C18H23N3O4 — CID 119368330
(2R)-2-[(1-cyclopentyl-2-oxo-3H-benzimidazole-5-carbonyl)amino]-3-methylbutanoic acid (PubChem CID 119368330) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is (2R)-2-[(1-cyclopentyl-2-oxo-3H-benzimidazole-5-carbonyl)amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(1-cyclopentyl-2-oxo-3H-benzimidazole-5-carbonyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 119368330 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (2R)-2-[(1-cyclopentyl-2-oxo-3H-benzimidazole-5-carbonyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)c1ccc2c(c1)[nH]c(=O)n2C1CCCC1)C(=O)O |
| InChI | InChI=1S/C18H23N3O4/c1-10(2)15(17(23)24)20-16(22)11-7-8-14-13(9-11)19-18(25)21(14)12-5-3-4-6-12/h7-10,12,15H,3-6H2,1-2H3,(H,19,25)(H,20,22)(H,23,24)/t15-/m1/s1 |
| InChIKey | UZVGGGXPICHIDW-OAHLLOKOSA-N |
| XLogP | 2.28 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |