C22H23N3O4 — CID 119366962
(2R)-2-[(1-cyclopentyl-2-oxo-3H-benzimidazole-5-carbonyl)amino]-3-phenylpropanoic acid (PubChem CID 119366962) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is (2R)-2-[(1-cyclopentyl-2-oxo-3H-benzimidazole-5-carbonyl)amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[(1-cyclopentyl-2-oxo-3H-benzimidazole-5-carbonyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 119366962 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (2R)-2-[(1-cyclopentyl-2-oxo-3H-benzimidazole-5-carbonyl)amino]-3-phenylpropanoic acid |
| SMILES | O=C(N[C@H](Cc1ccccc1)C(=O)O)c1ccc2c(c1)[nH]c(=O)n2C1CCCC1 |
| InChI | InChI=1S/C22H23N3O4/c26-20(23-18(21(27)28)12-14-6-2-1-3-7-14)15-10-11-19-17(13-15)24-22(29)25(19)16-8-4-5-9-16/h1-3,6-7,10-11,13,16,18H,4-5,8-9,12H2,(H,23,26)(H,24,29)(H,27,28)/t18-/m1/s1 |
| InChIKey | PANAXPHUBPQHJT-GOSISDBHSA-N |
| XLogP | 2.87 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |