C23H28N4O — CID 136523930
2-[1-(4-benzyl-3,3-dimethylpiperazin-1-yl)ethyl]-3H-quinazolin-4-one (PubChem CID 136523930) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-[1-(4-benzyl-3,3-dimethylpiperazin-1-yl)ethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[1-(4-benzyl-3,3-dimethylpiperazin-1-yl)ethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136523930 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 2-[1-(4-benzyl-3,3-dimethylpiperazin-1-yl)ethyl]-3H-quinazolin-4-one |
| SMILES | CC(c1nc2ccccc2c(=O)[nH]1)N1CCN(Cc2ccccc2)C(C)(C)C1 |
| InChI | InChI=1S/C23H28N4O/c1-17(21-24-20-12-8-7-11-19(20)22(28)25-21)26-13-14-27(23(2,3)16-26)15-18-9-5-4-6-10-18/h4-12,17H,13-16H2,1-3H3,(H,24,25,28) |
| InChIKey | VSMBAWUIBLULNL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |