C17H25N3O3S — CID 136523972
N-(2-methylsulfonylphenyl)-2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carboxamide (PubChem CID 136523972) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is N-(2-methylsulfonylphenyl)-2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carboxamide.
| Compound Name | N-(2-methylsulfonylphenyl)-2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 136523972 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-(2-methylsulfonylphenyl)-2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carboxamide |
| SMILES | CS(=O)(=O)c1ccccc1NC(=O)N1CCCC1CN1CCCC1 |
| InChI | InChI=1S/C17H25N3O3S/c1-24(22,23)16-9-3-2-8-15(16)18-17(21)20-12-6-7-14(20)13-19-10-4-5-11-19/h2-3,8-9,14H,4-7,10-13H2,1H3,(H,18,21) |
| InChIKey | QYYJNHHDXFFGFZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |