C16H23ClN4O2 — CID 97453908
(2S)-N-(2-chloro-3-pyridinyl)-2-(morpholin-4-ylmethyl)piperidine-1-carboxamide (PubChem CID 97453908) has the molecular formula C16H23ClN4O2 and a molecular weight of 338.84 g/mol. Its IUPAC name is (2S)-N-(2-chloro-3-pyridinyl)-2-(morpholin-4-ylmethyl)piperidine-1-carboxamide.
| Compound Name | (2S)-N-(2-chloro-3-pyridinyl)-2-(morpholin-4-ylmethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97453908 |
| Molecular Formula | C16H23ClN4O2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (2S)-N-(2-chloro-3-pyridinyl)-2-(morpholin-4-ylmethyl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1cccnc1Cl)N1CCCC[C@H]1CN1CCOCC1 |
| InChI | InChI=1S/C16H23ClN4O2/c17-15-14(5-3-6-18-15)19-16(22)21-7-2-1-4-13(21)12-20-8-10-23-11-9-20/h3,5-6,13H,1-2,4,7-12H2,(H,19,22)/t13-/m0/s1 |
| InChIKey | UBKJYOJYZLPLHF-ZDUSSCGKSA-N |
| XLogP | 2.45 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|