C18H24N4O3 — CID 136524524
N-(3,4-dimethoxyphenyl)-2-(4-pyrazol-1-ylpiperidin-1-yl)acetamide (PubChem CID 136524524) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-(4-pyrazol-1-ylpiperidin-1-yl)acetamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-(4-pyrazol-1-ylpiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 136524524 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-(4-pyrazol-1-ylpiperidin-1-yl)acetamide |
| SMILES | COc1ccc(NC(=O)CN2CCC(n3cccn3)CC2)cc1OC |
| InChI | InChI=1S/C18H24N4O3/c1-24-16-5-4-14(12-17(16)25-2)20-18(23)13-21-10-6-15(7-11-21)22-9-3-8-19-22/h3-5,8-9,12,15H,6-7,10-11,13H2,1-2H3,(H,20,23) |
| InChIKey | DBQWYLXIAGBHIE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |