C18H22N6OS — CID 136525086
1-methyl-1-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)-3-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]urea (PubChem CID 136525086) has the molecular formula C18H22N6OS and a molecular weight of 370.48 g/mol. Its IUPAC name is 1-methyl-1-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)-3-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]urea.
| Compound Name | 1-methyl-1-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)-3-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 136525086 |
| Molecular Formula | C18H22N6OS |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 1-methyl-1-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)-3-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]urea |
| SMILES | Cc1nc2c(s1)C(N(C)C(=O)NC(C)c1nnc3ccccn13)CCC2 |
| InChI | InChI=1S/C18H22N6OS/c1-11(17-22-21-15-9-4-5-10-24(15)17)19-18(25)23(3)14-8-6-7-13-16(14)26-12(2)20-13/h4-5,9-11,14H,6-8H2,1-3H3,(H,19,25) |
| InChIKey | NJPKBDPYBLYGCZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |