C23H23N5O — CID 134030672
7-methyl-N-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-1,2,3,4-tetrahydroacridine-9-carboxamide (PubChem CID 134030672) has the molecular formula C23H23N5O and a molecular weight of 385.47 g/mol. Its IUPAC name is 7-methyl-N-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-1,2,3,4-tetrahydroacridine-9-carboxamide.
| Compound Name | 7-methyl-N-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-1,2,3,4-tetrahydroacridine-9-carboxamide |
|---|---|
| PubChem CID | 134030672 |
| Molecular Formula | C23H23N5O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 7-methyl-N-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-1,2,3,4-tetrahydroacridine-9-carboxamide |
| SMILES | Cc1ccc2nc3c(c(C(=O)NC(C)c4nnc5ccccn45)c2c1)CCCC3 |
| InChI | InChI=1S/C23H23N5O/c1-14-10-11-19-17(13-14)21(16-7-3-4-8-18(16)25-19)23(29)24-15(2)22-27-26-20-9-5-6-12-28(20)22/h5-6,9-13,15H,3-4,7-8H2,1-2H3,(H,24,29) |
| InChIKey | GNVXVQSXCDOWDW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |