C17H22N2O4S — CID 136525098
N-cyclohexylsulfonyl-2-(2-oxo-3,4-dihydroquinolin-1-yl)acetamide (PubChem CID 136525098) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is N-cyclohexylsulfonyl-2-(2-oxo-3,4-dihydroquinolin-1-yl)acetamide.
| Compound Name | N-cyclohexylsulfonyl-2-(2-oxo-3,4-dihydroquinolin-1-yl)acetamide |
|---|---|
| PubChem CID | 136525098 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-cyclohexylsulfonyl-2-(2-oxo-3,4-dihydroquinolin-1-yl)acetamide |
| SMILES | O=C(CN1C(=O)CCc2ccccc21)NS(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C17H22N2O4S/c20-16(18-24(22,23)14-7-2-1-3-8-14)12-19-15-9-5-4-6-13(15)10-11-17(19)21/h4-6,9,14H,1-3,7-8,10-12H2,(H,18,20) |
| InChIKey | AMQZURPZTDIRPV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |