C20H22N4O3 — CID 136526263
1-benzoyl-N-[3-(carbamoylamino)phenyl]-2-methylpyrrolidine-2-carboxamide (PubChem CID 136526263) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 1-benzoyl-N-[3-(carbamoylamino)phenyl]-2-methylpyrrolidine-2-carboxamide.
| Compound Name | 1-benzoyl-N-[3-(carbamoylamino)phenyl]-2-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 136526263 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-benzoyl-N-[3-(carbamoylamino)phenyl]-2-methylpyrrolidine-2-carboxamide |
| SMILES | CC1(C(=O)Nc2cccc(NC(N)=O)c2)CCCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H22N4O3/c1-20(11-6-12-24(20)17(25)14-7-3-2-4-8-14)18(26)22-15-9-5-10-16(13-15)23-19(21)27/h2-5,7-10,13H,6,11-12H2,1H3,(H,22,26)(H3,21,23,27) |
| InChIKey | OWPYHXOUPRLSPY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |