C19H24N2O4 — CID 56805895
cyclopropylmethyl 2-[(1-benzoyl-2-methylpyrrolidine-2-carbonyl)amino]acetate (PubChem CID 56805895) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is cyclopropylmethyl 2-[(1-benzoyl-2-methylpyrrolidine-2-carbonyl)amino]acetate.
| Compound Name | cyclopropylmethyl 2-[(1-benzoyl-2-methylpyrrolidine-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 56805895 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | cyclopropylmethyl 2-[(1-benzoyl-2-methylpyrrolidine-2-carbonyl)amino]acetate |
| SMILES | CC1(C(=O)NCC(=O)OCC2CC2)CCCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H24N2O4/c1-19(18(24)20-12-16(22)25-13-14-8-9-14)10-5-11-21(19)17(23)15-6-3-2-4-7-15/h2-4,6-7,14H,5,8-13H2,1H3,(H,20,24) |
| InChIKey | HOUZHPBRVQLNFP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |