C18H14BrN3O3 — CID 136526527
(8-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-(6-nitro-1H-indol-3-yl)methanone (PubChem CID 136526527) has the molecular formula C18H14BrN3O3 and a molecular weight of 400.23 g/mol. Its IUPAC name is (8-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-(6-nitro-1H-indol-3-yl)methanone.
| Compound Name | (8-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-(6-nitro-1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 136526527 |
| Molecular Formula | C18H14BrN3O3 |
| Molecular Weight | 400.23 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | (8-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-(6-nitro-1H-indol-3-yl)methanone |
| SMILES | O=C(c1c[nH]c2cc([N+](=O)[O-])ccc12)N1CCc2cccc(Br)c2C1 |
| InChI | InChI=1S/C18H14BrN3O3/c19-16-3-1-2-11-6-7-21(10-15(11)16)18(23)14-9-20-17-8-12(22(24)25)4-5-13(14)17/h1-5,8-9,20H,6-7,10H2 |
| InChIKey | JOAHGFNIHGZVCK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 79.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.23 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|