C17H22N6O — CID 136526716
2-(cyclohexen-1-yl)-1-[4-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperazin-1-yl]ethanone (PubChem CID 136526716) has the molecular formula C17H22N6O and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-1-[4-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperazin-1-yl]ethanone.
| Compound Name | 2-(cyclohexen-1-yl)-1-[4-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 136526716 |
| Molecular Formula | C17H22N6O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 2-(cyclohexen-1-yl)-1-[4-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperazin-1-yl]ethanone |
| SMILES | O=C(CC1=CCCCC1)N1CCN(c2ccc3nncn3n2)CC1 |
| InChI | InChI=1S/C17H22N6O/c24-17(12-14-4-2-1-3-5-14)22-10-8-21(9-11-22)16-7-6-15-19-18-13-23(15)20-16/h4,6-7,13H,1-3,5,8-12H2 |
| InChIKey | PKIBNDKZARJFGO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|