C19H18N6O — CID 162386724
2-(3-ethynylphenyl)-1-[4-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperazin-1-yl]ethanone (PubChem CID 162386724) has the molecular formula C19H18N6O and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-(3-ethynylphenyl)-1-[4-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperazin-1-yl]ethanone.
| Compound Name | 2-(3-ethynylphenyl)-1-[4-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 162386724 |
| Molecular Formula | C19H18N6O |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 2-(3-ethynylphenyl)-1-[4-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperazin-1-yl]ethanone |
| SMILES | C#Cc1cccc(CC(=O)N2CCN(c3ccc4nncn4n3)CC2)c1 |
| InChI | InChI=1S/C19H18N6O/c1-2-15-4-3-5-16(12-15)13-19(26)24-10-8-23(9-11-24)18-7-6-17-21-20-14-25(17)22-18/h1,3-7,12,14H,8-11,13H2 |
| InChIKey | LBKVEXHPZOFVLT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 66.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|