C21H24N2O3 — CID 136526903
N-(6,7-dimethyl-2,3-dihydro-1-benzofuran-3-yl)-2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carboxamide (PubChem CID 136526903) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is N-(6,7-dimethyl-2,3-dihydro-1-benzofuran-3-yl)-2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carboxamide.
| Compound Name | N-(6,7-dimethyl-2,3-dihydro-1-benzofuran-3-yl)-2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 136526903 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-(6,7-dimethyl-2,3-dihydro-1-benzofuran-3-yl)-2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carboxamide |
| SMILES | Cc1ccc2c(c1C)OCC2NC(=O)c1cc2c([nH]c1=O)CCCCC2 |
| InChI | InChI=1S/C21H24N2O3/c1-12-8-9-15-18(11-26-19(15)13(12)2)23-21(25)16-10-14-6-4-3-5-7-17(14)22-20(16)24/h8-10,18H,3-7,11H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | MYJSYORWCPULEF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |