C19H18N2O4 — CID 33330887
N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide (PubChem CID 33330887) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 33330887 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide |
| SMILES | O=C1CCCc2[nH]c(=O)c(C(=O)N[C@@H]3CCOc4ccccc43)cc21 |
| InChI | InChI=1S/C19H18N2O4/c22-16-6-3-5-14-12(16)10-13(18(23)20-14)19(24)21-15-8-9-25-17-7-2-1-4-11(15)17/h1-2,4,7,10,15H,3,5-6,8-9H2,(H,20,23)(H,21,24)/t15-/m1/s1 |
| InChIKey | WMPSIILTWRGBNE-OAHLLOKOSA-N |
| XLogP | 2.15 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |