C16H18F2N2O4 — CID 136529091
2-(cyclopentyloxymethyl)-7-(difluoromethoxy)-6-methoxy-3H-quinazolin-4-one (PubChem CID 136529091) has the molecular formula C16H18F2N2O4 and a molecular weight of 340.33 g/mol. Its IUPAC name is 2-(cyclopentyloxymethyl)-7-(difluoromethoxy)-6-methoxy-3H-quinazolin-4-one.
| Compound Name | 2-(cyclopentyloxymethyl)-7-(difluoromethoxy)-6-methoxy-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136529091 |
| Molecular Formula | C16H18F2N2O4 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-(cyclopentyloxymethyl)-7-(difluoromethoxy)-6-methoxy-3H-quinazolin-4-one |
| SMILES | COc1cc2c(=O)[nH]c(COC3CCCC3)nc2cc1OC(F)F |
| InChI | InChI=1S/C16H18F2N2O4/c1-22-12-6-10-11(7-13(12)24-16(17)18)19-14(20-15(10)21)8-23-9-4-2-3-5-9/h6-7,9,16H,2-5,8H2,1H3,(H,19,20,21) |
| InChIKey | DCJSFSQMNKXJRM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |