C17H24N6O2 — CID 136529661
3-(1-methylpyrazol-4-yl)-N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]pyrrolidine-1-carboxamide (PubChem CID 136529661) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 3-(1-methylpyrazol-4-yl)-N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]pyrrolidine-1-carboxamide.
| Compound Name | 3-(1-methylpyrazol-4-yl)-N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 136529661 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 3-(1-methylpyrazol-4-yl)-N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]pyrrolidine-1-carboxamide |
| SMILES | Cn1cc(C2CCN(C(=O)Nc3cnn(CC4CCCO4)c3)C2)cn1 |
| InChI | InChI=1S/C17H24N6O2/c1-21-9-14(7-18-21)13-4-5-22(10-13)17(24)20-15-8-19-23(11-15)12-16-3-2-6-25-16/h7-9,11,13,16H,2-6,10,12H2,1H3,(H,20,24) |
| InChIKey | OJYABYOWHIQSCR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |