C19H30N6O — CID 136530008
1-tert-butyl-3-methyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]pyrazole-4-carboxamide (PubChem CID 136530008) has the molecular formula C19H30N6O and a molecular weight of 358.49 g/mol. Its IUPAC name is 1-tert-butyl-3-methyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]pyrazole-4-carboxamide.
| Compound Name | 1-tert-butyl-3-methyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 136530008 |
| Molecular Formula | C19H30N6O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 1-tert-butyl-3-methyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]pyrazole-4-carboxamide |
| SMILES | Cc1nn(C(C)(C)C)cc1C(=O)NCCCc1nnc2n1CCCCC2 |
| InChI | InChI=1S/C19H30N6O/c1-14-15(13-25(23-14)19(2,3)4)18(26)20-11-8-10-17-22-21-16-9-6-5-7-12-24(16)17/h13H,5-12H2,1-4H3,(H,20,26) |
| InChIKey | HCNXGJJSXREEFA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|