C21H25N7O3 — CID 86884580
1-methyl-3-(4-nitrophenyl)-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]pyrazole-4-carboxamide (PubChem CID 86884580) has the molecular formula C21H25N7O3 and a molecular weight of 423.48 g/mol. Its IUPAC name is 1-methyl-3-(4-nitrophenyl)-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]pyrazole-4-carboxamide.
| Compound Name | 1-methyl-3-(4-nitrophenyl)-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 86884580 |
| Molecular Formula | C21H25N7O3 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 1-methyl-3-(4-nitrophenyl)-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]pyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NCCCc2nnc3n2CCCCC3)c(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C21H25N7O3/c1-26-14-17(20(25-26)15-8-10-16(11-9-15)28(30)31)21(29)22-12-5-7-19-24-23-18-6-3-2-4-13-27(18)19/h8-11,14H,2-7,12-13H2,1H3,(H,22,29) |
| InChIKey | SYAHXLYNKRWFQV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|