C18H22N4O3S — CID 136532770
N-(3-tert-butyl-2-hydroxyphenyl)-1,3-dimethylpyrazolo[5,4-b]pyridine-5-sulfonamide (PubChem CID 136532770) has the molecular formula C18H22N4O3S and a molecular weight of 374.47 g/mol. Its IUPAC name is N-(3-tert-butyl-2-hydroxyphenyl)-1,3-dimethylpyrazolo[5,4-b]pyridine-5-sulfonamide.
| Compound Name | N-(3-tert-butyl-2-hydroxyphenyl)-1,3-dimethylpyrazolo[5,4-b]pyridine-5-sulfonamide |
|---|---|
| PubChem CID | 136532770 |
| Molecular Formula | C18H22N4O3S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-(3-tert-butyl-2-hydroxyphenyl)-1,3-dimethylpyrazolo[5,4-b]pyridine-5-sulfonamide |
| SMILES | Cc1nn(C)c2ncc(S(=O)(=O)Nc3cccc(C(C)(C)C)c3O)cc12 |
| InChI | InChI=1S/C18H22N4O3S/c1-11-13-9-12(10-19-17(13)22(5)20-11)26(24,25)21-15-8-6-7-14(16(15)23)18(2,3)4/h6-10,21,23H,1-5H3 |
| InChIKey | XGKLBJCKEQHAOY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|