C13H22N2O6S — CID 136533082
1-[2-(oxan-4-ylmethylsulfonylamino)ethyl]-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 136533082) has the molecular formula C13H22N2O6S and a molecular weight of 334.39 g/mol. Its IUPAC name is 1-[2-(oxan-4-ylmethylsulfonylamino)ethyl]-5-oxopyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-(oxan-4-ylmethylsulfonylamino)ethyl]-5-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 136533082 |
| Molecular Formula | C13H22N2O6S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 1-[2-(oxan-4-ylmethylsulfonylamino)ethyl]-5-oxopyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CC(=O)N(CCNS(=O)(=O)CC2CCOCC2)C1 |
| InChI | InChI=1S/C13H22N2O6S/c16-12-7-11(13(17)18)8-15(12)4-3-14-22(19,20)9-10-1-5-21-6-2-10/h10-11,14H,1-9H2,(H,17,18) |
| InChIKey | XAFTYWXOWCOROL-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |