C15H23NO4S2 — CID 136534212
3-methylsulfonyl-1-[1-(4-methylsulfonylphenyl)ethyl]piperidine (PubChem CID 136534212) has the molecular formula C15H23NO4S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 3-methylsulfonyl-1-[1-(4-methylsulfonylphenyl)ethyl]piperidine.
| Compound Name | 3-methylsulfonyl-1-[1-(4-methylsulfonylphenyl)ethyl]piperidine |
|---|---|
| PubChem CID | 136534212 |
| Molecular Formula | C15H23NO4S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 3-methylsulfonyl-1-[1-(4-methylsulfonylphenyl)ethyl]piperidine |
| SMILES | CC(c1ccc(S(C)(=O)=O)cc1)N1CCCC(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C15H23NO4S2/c1-12(13-6-8-14(9-7-13)21(2,17)18)16-10-4-5-15(11-16)22(3,19)20/h6-9,12,15H,4-5,10-11H2,1-3H3 |
| InChIKey | VOGDMLYCUNIALO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |