C15H23NO2S2 — CID 100640488
(2R)-2-ethyl-4-[(1R)-1-(4-methylsulfonylphenyl)ethyl]thiomorpholine (PubChem CID 100640488) has the molecular formula C15H23NO2S2 and a molecular weight of 313.49 g/mol. Its IUPAC name is (2R)-2-ethyl-4-[(1R)-1-(4-methylsulfonylphenyl)ethyl]thiomorpholine.
| Compound Name | (2R)-2-ethyl-4-[(1R)-1-(4-methylsulfonylphenyl)ethyl]thiomorpholine |
|---|---|
| PubChem CID | 100640488 |
| Molecular Formula | C15H23NO2S2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | (2R)-2-ethyl-4-[(1R)-1-(4-methylsulfonylphenyl)ethyl]thiomorpholine |
| SMILES | CC[C@@H]1CN([C@H](C)c2ccc(S(C)(=O)=O)cc2)CCS1 |
| InChI | InChI=1S/C15H23NO2S2/c1-4-14-11-16(9-10-19-14)12(2)13-5-7-15(8-6-13)20(3,17)18/h5-8,12,14H,4,9-11H2,1-3H3/t12-,14-/m1/s1 |
| InChIKey | YWISUGUYDFBLDO-TZMCWYRMSA-N |
| XLogP | 2.98 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |