C15H18Cl2N2O3 — CID 136534377
4-(3,4-dichloro-2-hydroxybenzoyl)-3-(2-methylpropyl)piperazin-2-one (PubChem CID 136534377) has the molecular formula C15H18Cl2N2O3 and a molecular weight of 345.23 g/mol. Its IUPAC name is 4-(3,4-dichloro-2-hydroxybenzoyl)-3-(2-methylpropyl)piperazin-2-one.
| Compound Name | 4-(3,4-dichloro-2-hydroxybenzoyl)-3-(2-methylpropyl)piperazin-2-one |
|---|---|
| PubChem CID | 136534377 |
| Molecular Formula | C15H18Cl2N2O3 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 4-(3,4-dichloro-2-hydroxybenzoyl)-3-(2-methylpropyl)piperazin-2-one |
| SMILES | CC(C)CC1C(=O)NCCN1C(=O)c1ccc(Cl)c(Cl)c1O |
| InChI | InChI=1S/C15H18Cl2N2O3/c1-8(2)7-11-14(21)18-5-6-19(11)15(22)9-3-4-10(16)12(17)13(9)20/h3-4,8,11,20H,5-7H2,1-2H3,(H,18,21) |
| InChIKey | JDXQCMFMLKPFRI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |