About (6-methoxy-1,3-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(6-methylpyridazin-4-yl)methanone
(6-methoxy-1,3-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(6-methylpyridazin-4-yl)methanone (PubChem CID 136534984) has the molecular formula C18H21N3O2
and a molecular weight of 311.39 g/mol. Its IUPAC name is (6-methoxy-1,3-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(6-methylpyridazin-4-yl)methanone.
Molecular Properties
| Compound Name | (6-methoxy-1,3-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(6-methylpyridazin-4-yl)methanone |
| PubChem CID | 136534984 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (6-methoxy-1,3-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(6-methylpyridazin-4-yl)methanone |
| SMILES | COc1ccc2c(c1)CC(C)N(C(=O)c1cnnc(C)c1)C2C |
| InChI | InChI=1S/C18H21N3O2/c1-11-7-15(10-19-20-11)18(22)21-12(2)8-14-9-16(23-4)5-6-17(14)13(21)3/h5-7,9-10,12-13H,8H2,1-4H3 |
| InChIKey | SRYVKXXSOPSOSP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-methoxy-1,3-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(6-methylpyridazin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methoxy-1,3-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(6-methylpyridazin-4-yl)methanone?
The IUPAC name of (6-methoxy-1,3-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(6-methylpyridazin-4-yl)methanone (CID 136534984) is (6-methoxy-1,3-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(6-methylpyridazin-4-yl)methanone.
What is the SMILES notation for (6-methoxy-1,3-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(6-methylpyridazin-4-yl)methanone?
The canonical SMILES for (6-methoxy-1,3-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(6-methylpyridazin-4-yl)methanone is COc1ccc2c(c1)CC(C)N(C(=O)c1cnnc(C)c1)C2C.
What is the InChIKey of (6-methoxy-1,3-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(6-methylpyridazin-4-yl)methanone?
The InChIKey is SRYVKXXSOPSOSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O2/c1-11-7-15(10-19-20-11)18(22)21-12(2)8-14-9-16(23-4)5-6-17(14)13(21)3/h5-7,9-10,12-13H,8H2,1-4H3.
What are the key properties of (6-methoxy-1,3-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(6-methylpyridazin-4-yl)methanone?
(6-methoxy-1,3-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(6-methylpyridazin-4-yl)methanone has a molecular weight of 311.39 g/mol, XLogP of 2.94, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methoxy-1,3-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(6-methylpyridazin-4-yl)methanone is sourced from PubChem (CID 136534984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).