C18H26N6O — CID 136535043
2-(6-aminopurin-9-yl)-N-spiro[5.5]undecan-3-ylacetamide (PubChem CID 136535043) has the molecular formula C18H26N6O and a molecular weight of 342.45 g/mol. Its IUPAC name is 2-(6-aminopurin-9-yl)-N-spiro[5.5]undecan-3-ylacetamide.
| Compound Name | 2-(6-aminopurin-9-yl)-N-spiro[5.5]undecan-3-ylacetamide |
|---|---|
| PubChem CID | 136535043 |
| Molecular Formula | C18H26N6O |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 2-(6-aminopurin-9-yl)-N-spiro[5.5]undecan-3-ylacetamide |
| SMILES | Nc1ncnc2c1ncn2CC(=O)NC1CCC2(CCCCC2)CC1 |
| InChI | InChI=1S/C18H26N6O/c19-16-15-17(21-11-20-16)24(12-22-15)10-14(25)23-13-4-8-18(9-5-13)6-2-1-3-7-18/h11-13H,1-10H2,(H,23,25)(H2,19,20,21) |
| InChIKey | FCWXZCCKAATLSQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |