C16H29N5O2S — CID 136537496
4-[(2-amino-4-pyridinyl)methyl]-N,N-dipropylpiperazine-1-sulfonamide (PubChem CID 136537496) has the molecular formula C16H29N5O2S and a molecular weight of 355.51 g/mol. Its IUPAC name is 4-[(2-amino-4-pyridinyl)methyl]-N,N-dipropylpiperazine-1-sulfonamide.
| Compound Name | 4-[(2-amino-4-pyridinyl)methyl]-N,N-dipropylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 136537496 |
| Molecular Formula | C16H29N5O2S |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 4-[(2-amino-4-pyridinyl)methyl]-N,N-dipropylpiperazine-1-sulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)N1CCN(Cc2ccnc(N)c2)CC1 |
| InChI | InChI=1S/C16H29N5O2S/c1-3-7-20(8-4-2)24(22,23)21-11-9-19(10-12-21)14-15-5-6-18-16(17)13-15/h5-6,13H,3-4,7-12,14H2,1-2H3,(H2,17,18) |
| InChIKey | HPJPDHSRVXJJKE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |