C18H29N3O4S — CID 122033461
3-[[4-(dipropylsulfamoyl)piperazin-1-yl]methyl]benzoic acid (PubChem CID 122033461) has the molecular formula C18H29N3O4S and a molecular weight of 383.51 g/mol. Its IUPAC name is 3-[[4-(dipropylsulfamoyl)piperazin-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[4-(dipropylsulfamoyl)piperazin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 122033461 |
| Molecular Formula | C18H29N3O4S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 3-[[4-(dipropylsulfamoyl)piperazin-1-yl]methyl]benzoic acid |
| SMILES | CCCN(CCC)S(=O)(=O)N1CCN(Cc2cccc(C(=O)O)c2)CC1 |
| InChI | InChI=1S/C18H29N3O4S/c1-3-8-20(9-4-2)26(24,25)21-12-10-19(11-13-21)15-16-6-5-7-17(14-16)18(22)23/h5-7,14H,3-4,8-13,15H2,1-2H3,(H,22,23) |
| InChIKey | VVTZLGPLDLLYRD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |