C12H14N4O3 — CID 136538736
N-[5-(oxan-3-yl)-1H-pyrazol-3-yl]-1,2-oxazole-3-carboxamide (PubChem CID 136538736) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is N-[5-(oxan-3-yl)-1H-pyrazol-3-yl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-[5-(oxan-3-yl)-1H-pyrazol-3-yl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 136538736 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | N-[5-(oxan-3-yl)-1H-pyrazol-3-yl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1cc(C2CCCOC2)[nH]n1)c1ccon1 |
| InChI | InChI=1S/C12H14N4O3/c17-12(9-3-5-19-16-9)13-11-6-10(14-15-11)8-2-1-4-18-7-8/h3,5-6,8H,1-2,4,7H2,(H2,13,14,15,17) |
| InChIKey | IICRDKBJKPYECF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |