C16H23N3O4 — CID 136543616
N-[5-(oxan-3-yl)-1H-pyrazol-3-yl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyran-1-carboxamide (PubChem CID 136543616) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is N-[5-(oxan-3-yl)-1H-pyrazol-3-yl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyran-1-carboxamide.
| Compound Name | N-[5-(oxan-3-yl)-1H-pyrazol-3-yl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyran-1-carboxamide |
|---|---|
| PubChem CID | 136543616 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | N-[5-(oxan-3-yl)-1H-pyrazol-3-yl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyran-1-carboxamide |
| SMILES | O=C(Nc1cc(C2CCCOC2)[nH]n1)C1OCC2COCCC21 |
| InChI | InChI=1S/C16H23N3O4/c20-16(15-12-3-5-22-8-11(12)9-23-15)17-14-6-13(18-19-14)10-2-1-4-21-7-10/h6,10-12,15H,1-5,7-9H2,(H2,17,18,19,20) |
| InChIKey | MDHBBAFOZLCTIF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |