C20H26N4O2 — CID 136539634
4-(2-cyanophenyl)-N-[(2-prop-1-en-2-yloxolan-3-yl)methyl]piperazine-1-carboxamide (PubChem CID 136539634) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-(2-cyanophenyl)-N-[(2-prop-1-en-2-yloxolan-3-yl)methyl]piperazine-1-carboxamide.
| Compound Name | 4-(2-cyanophenyl)-N-[(2-prop-1-en-2-yloxolan-3-yl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 136539634 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 4-(2-cyanophenyl)-N-[(2-prop-1-en-2-yloxolan-3-yl)methyl]piperazine-1-carboxamide |
| SMILES | C=C(C)C1OCCC1CNC(=O)N1CCN(c2ccccc2C#N)CC1 |
| InChI | InChI=1S/C20H26N4O2/c1-15(2)19-17(7-12-26-19)14-22-20(25)24-10-8-23(9-11-24)18-6-4-3-5-16(18)13-21/h3-6,17,19H,1,7-12,14H2,2H3,(H,22,25) |
| InChIKey | KHYQXYIHOFBYTM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|