C18H23N3O2 — CID 94115032
2-[4-[2-[(2R)-oxolan-2-yl]acetyl]-1,4-diazepan-1-yl]benzonitrile (PubChem CID 94115032) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-[4-[2-[(2R)-oxolan-2-yl]acetyl]-1,4-diazepan-1-yl]benzonitrile.
| Compound Name | 2-[4-[2-[(2R)-oxolan-2-yl]acetyl]-1,4-diazepan-1-yl]benzonitrile |
|---|---|
| PubChem CID | 94115032 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 2-[4-[2-[(2R)-oxolan-2-yl]acetyl]-1,4-diazepan-1-yl]benzonitrile |
| SMILES | N#Cc1ccccc1N1CCCN(C(=O)C[C@H]2CCCO2)CC1 |
| InChI | InChI=1S/C18H23N3O2/c19-14-15-5-1-2-7-17(15)20-8-4-9-21(11-10-20)18(22)13-16-6-3-12-23-16/h1-2,5,7,16H,3-4,6,8-13H2/t16-/m1/s1 |
| InChIKey | KLXXQGYOKBZZQC-MRXNPFEDSA-N |
| XLogP | 2.17 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |