C17H14FN3O3S — CID 136543123
3-[[2-(1-phenylpyrazol-3-yl)acetyl]amino]benzenesulfonyl fluoride (PubChem CID 136543123) has the molecular formula C17H14FN3O3S and a molecular weight of 359.38 g/mol. Its IUPAC name is 3-[[2-(1-phenylpyrazol-3-yl)acetyl]amino]benzenesulfonyl fluoride.
| Compound Name | 3-[[2-(1-phenylpyrazol-3-yl)acetyl]amino]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 136543123 |
| Molecular Formula | C17H14FN3O3S |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 3-[[2-(1-phenylpyrazol-3-yl)acetyl]amino]benzenesulfonyl fluoride |
| SMILES | O=C(Cc1ccn(-c2ccccc2)n1)Nc1cccc(S(=O)(=O)F)c1 |
| InChI | InChI=1S/C17H14FN3O3S/c18-25(23,24)16-8-4-5-13(11-16)19-17(22)12-14-9-10-21(20-14)15-6-2-1-3-7-15/h1-11H,12H2,(H,19,22) |
| InChIKey | ZXPDQXSGBFEMPP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |