C23H22N4O3S2 — CID 4560229
N-[3-(dimethylsulfamoyl)phenyl]-2-(1-phenylbenzimidazol-2-yl)sulfanylacetamide (PubChem CID 4560229) has the molecular formula C23H22N4O3S2 and a molecular weight of 466.59 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)phenyl]-2-(1-phenylbenzimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-[3-(dimethylsulfamoyl)phenyl]-2-(1-phenylbenzimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 4560229 |
| Molecular Formula | C23H22N4O3S2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)phenyl]-2-(1-phenylbenzimidazol-2-yl)sulfanylacetamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)CSc2nc3ccccc3n2-c2ccccc2)c1 |
| InChI | InChI=1S/C23H22N4O3S2/c1-26(2)32(29,30)19-12-8-9-17(15-19)24-22(28)16-31-23-25-20-13-6-7-14-21(20)27(23)18-10-4-3-5-11-18/h3-15H,16H2,1-2H3,(H,24,28) |
| InChIKey | PXVDBMGPPPQNQV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |