C27H21N5OS — CID 3620741
2-(1-phenylbenzimidazol-2-yl)sulfanyl-N-(4-phenyldiazenylphenyl)acetamide (PubChem CID 3620741) has the molecular formula C27H21N5OS and a molecular weight of 463.57 g/mol. Its IUPAC name is 2-(1-phenylbenzimidazol-2-yl)sulfanyl-N-(4-phenyldiazenylphenyl)acetamide.
| Compound Name | 2-(1-phenylbenzimidazol-2-yl)sulfanyl-N-(4-phenyldiazenylphenyl)acetamide |
|---|---|
| PubChem CID | 3620741 |
| Molecular Formula | C27H21N5OS |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 2-(1-phenylbenzimidazol-2-yl)sulfanyl-N-(4-phenyldiazenylphenyl)acetamide |
| SMILES | O=C(CSc1nc2ccccc2n1-c1ccccc1)Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C27H21N5OS/c33-26(28-20-15-17-22(18-16-20)31-30-21-9-3-1-4-10-21)19-34-27-29-24-13-7-8-14-25(24)32(27)23-11-5-2-6-12-23/h1-18H,19H2,(H,28,33)/b31-30+ |
| InChIKey | ZICINVDMWJYYPM-NVQSTNCTSA-N |
| XLogP | 7.17 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|