C30H25N5O2S — CID 4006533
2-[3-(3,5-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-phenyldiazenylphenyl)acetamide (PubChem CID 4006533) has the molecular formula C30H25N5O2S and a molecular weight of 519.63 g/mol. Its IUPAC name is 2-[3-(3,5-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-phenyldiazenylphenyl)acetamide.
| Compound Name | 2-[3-(3,5-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-phenyldiazenylphenyl)acetamide |
|---|---|
| PubChem CID | 4006533 |
| Molecular Formula | C30H25N5O2S |
| Molecular Weight | 519.63 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | 2-[3-(3,5-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-phenyldiazenylphenyl)acetamide |
| SMILES | Cc1cc(C)cc(-n2c(SCC(=O)Nc3ccc(/N=N/c4ccccc4)cc3)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C30H25N5O2S/c1-20-16-21(2)18-25(17-20)35-29(37)26-10-6-7-11-27(26)32-30(35)38-19-28(36)31-22-12-14-24(15-13-22)34-33-23-8-4-3-5-9-23/h3-18H,19H2,1-2H3,(H,31,36)/b34-33+ |
| InChIKey | OXOQRGIWIZEEFG-JEIPZWNWSA-N |
| XLogP | 7.15 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.63 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|